5-Acetyl-1(2)H-pyrazole-3-carboxylic acid ethyl ester
5-Acetyl-1(2)H-pyrazole-3-carboxylic acid ethyl ester structure
|
Common Name | 5-Acetyl-1(2)H-pyrazole-3-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 37622-89-2 | Molecular Weight | 182.17700 | |
| Density | 1.240±0.06 g/cm3(Predicted) | Boiling Point | 382.6±27.0 °C(Predicted) | |
| Molecular Formula | C8H10N2O3 | Melting Point | 112-112.5 °C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 5-acetyl-1H-pyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.240±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 382.6±27.0 °C(Predicted) |
| Melting Point | 112-112.5 °C |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.17700 |
| Exact Mass | 182.06900 |
| PSA | 72.05000 |
| LogP | 0.78900 |
| InChIKey | DUGSTTIFTRKIBL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C(C)=O)n[nH]1 |
| Storage condition | 2-8°C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:3112-31-0
CAS#:949034-45-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-ethoxycarbonyl-5-acetylpyrazole |
| 5-acetyl-1H-pyrazole-3-carboxylic acid ethyl ester |
| ethyl 5-acetyl 1H-pyrazol-3-carboxylate |
| 5-Acetyl-1(2)H-pyrazol-3-carbonsaeure-aethylester |
| 5-acetyl-1(2)H-pyrazole-3-carboxylic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does ethyl 5-acetyl-1H-pyrazole-3-carboxylate have? |
| A: English synonyms of ethyl 5-acetyl-1H-pyrazole-3-carboxylate: 3-ethoxycarbonyl-5-acetylpyrazole, 5-acetyl-1H-pyrazole-3-carboxylic acid ethyl ester, ethyl 5-acetyl 1H-pyrazol-3-carboxylate, 5-Acetyl-1(2)H-pyrazol-3-carbonsaeure-aethylester, 5-acetyl-1(2)H-pyrazole-3-carboxylic acid ethyl ester. |
| Q: What is the polar surface area (PSA) of ethyl 5-acetyl-1H-pyrazole-3-carboxylate? |
| A: Polar surface area (PSA) of ethyl 5-acetyl-1H-pyrazole-3-carboxylate is 72.05000. |
| Q: What is the CAS number of ethyl 5-acetyl-1H-pyrazole-3-carboxylate? |
| A: CAS number of ethyl 5-acetyl-1H-pyrazole-3-carboxylate is 37622-89-2. |
| Q: What is the SMILES notation of ethyl 5-acetyl-1H-pyrazole-3-carboxylate? |
| A: SMILES notation of ethyl 5-acetyl-1H-pyrazole-3-carboxylate is CCOC(=O)c1cc(C(C)=O)n[nH]1. |
| Q: What is the English name of ethyl 5-acetyl-1H-pyrazole-3-carboxylate? |
| A: The English name of ethyl 5-acetyl-1H-pyrazole-3-carboxylate is ethyl 5-acetyl-1H-pyrazole-3-carboxylate. |
| Q: What is the molecular formula of ethyl 5-acetyl-1H-pyrazole-3-carboxylate? |
| A: Molecular formula of ethyl 5-acetyl-1H-pyrazole-3-carboxylate is C8H10N2O3. |
| Q: What is the InChIKey of ethyl 5-acetyl-1H-pyrazole-3-carboxylate? |
| A: InChIKey of ethyl 5-acetyl-1H-pyrazole-3-carboxylate is DUGSTTIFTRKIBL-UHFFFAOYSA-N. |
| Q: What are the storage conditions for ethyl 5-acetyl-1H-pyrazole-3-carboxylate? |
| A: Storage conditions for ethyl 5-acetyl-1H-pyrazole-3-carboxylate: 2-8°C. |
| Q: What is the melting point of ethyl 5-acetyl-1H-pyrazole-3-carboxylate? |
| A: Melting point of ethyl 5-acetyl-1H-pyrazole-3-carboxylate is 112-112.5 °C. |
| Q: What is the boiling point of ethyl 5-acetyl-1H-pyrazole-3-carboxylate? |
| A: Boiling point of ethyl 5-acetyl-1H-pyrazole-3-carboxylate is 382.6±27.0 °C(Predicted). |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |