diethyl-methyl-[3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]azanium,diiodide structure
|
Common Name | diethyl-methyl-[3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]azanium,diiodide | ||
|---|---|---|---|---|
| CAS Number | 37637-72-2 | Molecular Weight | 500.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H30I2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl-methyl-[3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]azanium,diiodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H30I2N2O2 |
|---|---|
| Molecular Weight | 500.19800 |
| Exact Mass | 500.04000 |
| PSA | 26.30000 |
| InChIKey | MTYZOLJPVGVHRL-UHFFFAOYSA-L |
| SMILES | CC[N+](C)(CC)CCC(=O)OCC[N+](C)(C)C.[I-].[I-] |
|
~%
diethyl-methyl-... CAS#:37637-72-2 |
| Literature: Halverstadt et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3618,3620 |
|
~%
diethyl-methyl-... CAS#:37637-72-2 |
| Literature: Halverstadt et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3618,3620 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(Diaethoxyphosphinyl)-propionsaeureanhydrid |
| 3-(Diaethyl-methyl-ammonio)-propionsaeure-(2-trimethylammonio-aethylester),Dijodid |
| 3-(diethyl-methyl-ammonio)-propionic acid-(2-trimethylammonio-ethyl ester),diiodide |
| 3-Diaethylyphosphono-propionsaeureanhydrid |
| Propanoic acid,3-(diethoxyphosphinyl)-,anhydride |