ethyl 4-[(4-chlorophenyl)amino]piperidine-1-carboxylate structure
|
Common Name | ethyl 4-[(4-chlorophenyl)amino]piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 37656-66-9 | Molecular Weight | 282.76600 | |
| Density | 1.237 g/cm3 | Boiling Point | 427.6ºC at 760 mmHg | |
| Molecular Formula | C14H19ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | ethyl 4-(4-chloroanilino)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237 g/cm3 |
|---|---|
| Boiling Point | 427.6ºC at 760 mmHg |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.76600 |
| Flash Point | 212.4ºC |
| Exact Mass | 282.11400 |
| PSA | 41.57000 |
| LogP | 3.38370 |
| Index of Refraction | 1.582 |
| InChIKey | MOVXNHXUSMSOGD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(Cl)cc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
ethyl 4-[(4-chl... CAS#:37656-66-9 |
| Literature: Janssen Pharmaceutica N.V. Patent: US4197304 A1, 1980 ; |
|
~%
ethyl 4-[(4-chl... CAS#:37656-66-9 |
| Literature: Adachi, Makoto; Sasakura, Kazuyuki; Sugasawa, Tsutomu Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 5 p. 1826 - 1835 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 4-[(4-chlorophenyl)amino]-1-piperidinecarboxylate |
| 4-(4-chloro-anilino)-piperidine-1-carboxylic acid ethyl ester |
| EINECS 253-578-3 |
| Ethyl 4-[(4-chlorophenyl)amino]piperidine-1-carboxylate |
| 4-chloro-N-(1-ethoxycarbonyl-4-piperidinyl)aniline |