ethyl (E)-3-(2-(trifluoromethyl)phenyl)acrylate
ethyl (E)-3-(2-(trifluoromethyl)phenyl)acrylate structure
|
Common Name | ethyl (E)-3-(2-(trifluoromethyl)phenyl)acrylate | ||
|---|---|---|---|---|
| CAS Number | 376641-48-4 | Molecular Weight | 244.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11F3O2 |
|---|---|
| Molecular Weight | 244.21000 |
| Exact Mass | 244.07100 |
| PSA | 26.30000 |
| LogP | 3.28170 |
| InChIKey | SMBXVOLINKNRSR-BQYQJAHWSA-N |
| SMILES | CCOC(=O)C=Cc1ccccc1C(F)(F)F |
| Storage condition | 2-8℃ |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:191155-80-3
CAS#:123486-66-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl (E)-3-(2-trifluoromethylphenyl)-2-propenoate |
| ethyl (E)-3-[2-(trifluoromethyl)phenyl]acrylate |
| (E)-ethyl 3-(2-trifluoromethylphenyl)prop-2-enoate |
| ethyl (E)-3-(2-trifluoromethylphenyl)prop-2-enoate |
| 2'-trifluoromethylcinnamic acid ethyl ester |
| (E)-ethyl 3-(2-(trifluoromethyl)phenyl)acrylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate? |
| A: CAS number of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate is 376641-48-4. |
| Q: What is the LogP of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate? |
| A: LogP of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate is 3.28170. |
| Q: What are the downstream products of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate? |
| A: Related downstream products(CAS) of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate: 191155-80-3;123486-66-8. |
| Q: What is the polar surface area (PSA) of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate? |
| A: Polar surface area (PSA) of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate is 26.30000. |
| Q: What is the SMILES notation of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate? |
| A: SMILES notation of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate is CCOC(=O)C=Cc1ccccc1C(F)(F)F. |
| Q: What is the molecular formula of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate? |
| A: Molecular formula of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate is C12H11F3O2. |
| Q: What is the InChIKey of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate? |
| A: InChIKey of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate is SMBXVOLINKNRSR-BQYQJAHWSA-N. |
| Q: What is the molecular weight of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate? |
| A: Molecular weight of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate is 244.21000. |
| Q: What English synonyms does ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate have? |
| A: English synonyms of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate: ethyl (E)-3-(2-trifluoromethylphenyl)-2-propenoate, ethyl (E)-3-[2-(trifluoromethyl)phenyl]acrylate, (E)-ethyl 3-(2-trifluoromethylphenyl)prop-2-enoate, ethyl (E)-3-(2-trifluoromethylphenyl)prop-2-enoate, 2'-trifluoromethylcinnamic acid ethyl ester, (E)-ethyl 3-(2-(trifluoromethyl)phenyl)acrylate. |
| Q: What is the English name of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate? |
| A: The English name of ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate is ethyl (2E)-3-(2-trifluoromethylphenyl)propenoate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |