o-(p-hydroxybenzoyl)benzoic acid, compound with 1-[2-[3-(2,2-diphenylethyl)-1,2,4-oxadiazol-5-yl]ethyl]piperidine (1:1) structure
|
Common Name | o-(p-hydroxybenzoyl)benzoic acid, compound with 1-[2-[3-(2,2-diphenylethyl)-1,2,4-oxadiazol-5-yl]ethyl]piperidine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 37671-82-2 | Molecular Weight | 603.70700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H37N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2,2-diphenylethyl)-5-(2-piperidin-1-ylethyl)-1,2,4-oxadiazole,2-(4-hydroxybenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C37H37N3O5 |
|---|---|
| Molecular Weight | 603.70700 |
| Exact Mass | 603.27300 |
| PSA | 116.76000 |
| LogP | 6.73190 |
| InChIKey | DISMLHKPMHZZJD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc(O)cc1.c1ccc(C(Cc2noc(CCN3CCCCC3)n2)c2ccccc2)cc1 |
| UNII-VAT8R7N21U |
| Prenoxdiazine hibenzate |
| EINECS 253-584-6 |
| o-(p-hydroxybenzoyl)benzoic acid,compound with 1-{2-[3-(2,2-diphenylethyl)-1,2,4-oxadiazol-5-yl]ethyl}piperidine (1:1) |