1,2-Benzisothiazole,3-(2-propyn-1-ylthio)-, 1,1-dioxide structure
|
Common Name | 1,2-Benzisothiazole,3-(2-propyn-1-ylthio)-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 37671-90-2 | Molecular Weight | 237.29800 | |
| Density | 1.35g/cm3 | Boiling Point | 414ºC at 760 mmHg | |
| Molecular Formula | C10H7NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.2ºC | |
| Name | 3-prop-2-ynylsulfanyl-1,2-benzothiazole 1,1-dioxide |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 414ºC at 760 mmHg |
| Molecular Formula | C10H7NO2S2 |
| Molecular Weight | 237.29800 |
| Flash Point | 204.2ºC |
| Exact Mass | 236.99200 |
| PSA | 80.18000 |
| LogP | 2.01830 |
| Index of Refraction | 1.65 |
| InChIKey | NEKQIVPCQYRZNN-UHFFFAOYSA-N |
| SMILES | C#CCSC1=NS(=O)(=O)c2ccccc21 |
|
~81%
1,2-Benzisothia... CAS#:37671-90-2 |
| Literature: Inomata, Katsuhiko; Yamada, Hiroyuki; Kotake, Hiroshi Chemistry Letters, 1981 , p. 1457 - 1458 Title/Abstract Full Text Show Details Yamada, Hiroyuki; Kinoshita, Hideki; Inomata, Katsuhiko; Kotake, Hiroshi Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 3 p. 949 - 950 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |