methyl 2-[methyl(2-methylphenyl)amino]benzoate structure
|
Common Name | methyl 2-[methyl(2-methylphenyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 37676-00-9 | Molecular Weight | 255.31200 | |
| Density | 1.118g/cm3 | Boiling Point | 379ºC at 760 mmHg | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.8ºC | |
| Name | methyl 2-(N,2-dimethylanilino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 379ºC at 760 mmHg |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.31200 |
| Flash Point | 136.8ºC |
| Exact Mass | 255.12600 |
| PSA | 29.54000 |
| LogP | 3.54950 |
| Index of Refraction | 1.589 |
| InChIKey | CCEKAFYQQNLXEC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1N(C)c1ccccc1C |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| METHYL 2-[METHYL(2-METHYLPHENYL)AMINO]BENZOATE |
| EINECS 253-614-8 |
| 2-Methyl-2'-methoxycarbonyl-N-methyl-diphenylamin |