Chloroheptafluorocyclobutane structure
|
Common Name | Chloroheptafluorocyclobutane | ||
|---|---|---|---|---|
| CAS Number | 377-41-3 | Molecular Weight | 216.48500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4ClF7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-1,2,2,3,3,4,4-heptafluorocyclobutane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4ClF7 |
|---|---|
| Molecular Weight | 216.48500 |
| Exact Mass | 215.95800 |
| LogP | 2.81050 |
| InChIKey | KPEMHIJREABZQQ-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(Cl)C1(F)F |
| HS Code | 2903890090 |
|---|
|
~%
Chloroheptafluo... CAS#:377-41-3 |
| Literature: Lacher et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 1693 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Cyclobutane,chloroheptafluoro-(8CI,9CI) |
| Chlor-heptafluor-cyclobutan |
| chloroheptafluoro-cyclobutane |
| Cyclobutane,1-chloro-1,2,2,3,3,4,4-heptafluoro |