Perfluoroethoxypropionyl fluoride
Modify Date: 2025-10-19 18:07:23
Perfluoroethoxypropionyl fluoride structure
|
Common Name | Perfluoroethoxypropionyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 377-75-3 | Molecular Weight | 282.04 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5F10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Perfluoroethoxypropionyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5F10O2 |
|---|---|
| Molecular Weight | 282.04 |
| InChIKey | AOASPXLNDBBWJX-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Perfluoroethoxypropionyl fluoride? |
| A: Molecular formula of Perfluoroethoxypropionyl fluoride is C5F10O2. |
| Q: What is the Chinese name of 377-75-3? |
| A: Chinese name of 377-75-3 is 377-75-3. |
| Q: What is the English name of Perfluoroethoxypropionyl fluoride? |
| A: The English name of Perfluoroethoxypropionyl fluoride is Perfluoroethoxypropionyl fluoride. |
| Q: What is the molecular weight of Perfluoroethoxypropionyl fluoride? |
| A: Molecular weight of Perfluoroethoxypropionyl fluoride is 282.04. |
| Q: What is the InChIKey of Perfluoroethoxypropionyl fluoride? |
| A: InChIKey of Perfluoroethoxypropionyl fluoride is AOASPXLNDBBWJX-UHFFFAOYSA-N. |
| Q: What is the CAS number of Perfluoroethoxypropionyl fluoride? |
| A: CAS number of Perfluoroethoxypropionyl fluoride is 377-75-3. |
| Q: What is the SMILES notation of Perfluoroethoxypropionyl fluoride? |
| A: SMILES notation of Perfluoroethoxypropionyl fluoride is O=C(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)F. |