Propanedioic acid,2-(diethylamino)-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-(diethylamino)-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 37706-08-4 | Molecular Weight | 231.28900 | |
| Density | 1.029g/cm3 | Boiling Point | 279.1ºC at 760mmHg | |
| Molecular Formula | C11H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.6ºC | |
| Name | diethyl 2-(diethylamino)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.029g/cm3 |
|---|---|
| Boiling Point | 279.1ºC at 760mmHg |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.28900 |
| Flash Point | 122.6ºC |
| Exact Mass | 231.14700 |
| PSA | 55.84000 |
| LogP | 0.82300 |
| Index of Refraction | 1.448 |
| InChIKey | KPXMMPKVFUVJMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)N(CC)CC |
|
~58%
Propanedioic ac... CAS#:37706-08-4 |
| Literature: Maier, Ludwig; Lea, Peter J. Phosphorus and Sulfur and the Related Elements, 1983 , vol. 17, p. 1 - 20 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| diethylamino-malonic acid diethyl ester |
| Diaethylamino-malonsaeure-aethylester |
| diethyl (diethylamino)propanedioate |
| diethyl N,N-diethylaminomalonate |
| Diethylamino-malonsaeure-diethylester |
| Diaethylamino-malonsaeure-diaethylester |