4,5,6,7-Tetrabromo-2-(2,4,6-tribromophenyl)-1H-isoindole-1,3(2H)-dione structure
|
Common Name | 4,5,6,7-Tetrabromo-2-(2,4,6-tribromophenyl)-1H-isoindole-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 37710-57-9 | Molecular Weight | 775.49900 | |
| Density | 2.769g/cm3 | Boiling Point | 698.9ºC at 760 mmHg | |
| Molecular Formula | C14H2Br7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 376.5ºC | |
| Name | 4,5,6,7-tetrabromo-2-(2,4,6-tribromophenyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.769g/cm3 |
|---|---|
| Boiling Point | 698.9ºC at 760 mmHg |
| Molecular Formula | C14H2Br7NO2 |
| Molecular Weight | 775.49900 |
| Flash Point | 376.5ºC |
| Exact Mass | 768.43700 |
| PSA | 37.38000 |
| LogP | 7.88970 |
| Index of Refraction | 1.765 |
| InChIKey | MXOORBGSTYBSFP-UHFFFAOYSA-N |
| SMILES | O=C1c2c(Br)c(Br)c(Br)c(Br)c2C(=O)N1c1c(Br)cc(Br)cc1Br |
| HS Code | 2925190090 |
|---|
|
~%
4,5,6,7-Tetrabr... CAS#:37710-57-9 |
| Literature: Pratt; Young Journal of the American Chemical Society, 1918 , vol. 40, p. 1416 |
|
~%
4,5,6,7-Tetrabr... CAS#:37710-57-9 |
| Literature: Pratt; Young Journal of the American Chemical Society, 1918 , vol. 40, p. 1416 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,5,6,7-tetrabromo-2-(2,4,6-tribromo-phenyl)-isoindoline-1,3-dione |
| 4,5,6,7-Tetrabrom-2-(2,4,6-tribrom-phenyl)-isoindolin-1,3-dion |
| 1H-Isoindole-1,3(2H)-dione,4,5,6,7-tetrabromo-2-(2,4,6-tribromophenyl) |
| 4,5,6,7-Tetrabromo-2-(2,4,6-tribromophenyl)-1H-isoindole-1,3(2H)-dione |
| N-(2,4,6-Tribromophenyl)-3,4,5,6-tetrabromophthalimide |