2-Penten-1-ol,5-(3,3-dimethyl-2-oxiranyl)-3-methyl-, 1-acetate structure
|
Common Name | 2-Penten-1-ol,5-(3,3-dimethyl-2-oxiranyl)-3-methyl-, 1-acetate | ||
|---|---|---|---|---|
| CAS Number | 37715-31-4 | Molecular Weight | 212.28500 | |
| Density | 0.981g/cm3 | Boiling Point | 270.4ºC at 760mmHg | |
| Molecular Formula | C12H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.7ºC | |
| Name | [5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.981g/cm3 |
|---|---|
| Boiling Point | 270.4ºC at 760mmHg |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.28500 |
| Flash Point | 110.7ºC |
| Exact Mass | 212.14100 |
| PSA | 38.83000 |
| LogP | 2.45340 |
| Index of Refraction | 1.457 |
| InChIKey | ICJOOVLSDYCSCJ-VQHVLOKHSA-N |
| SMILES | CC(=O)OCC=C(C)CCC1OC1(C)C |
| HS Code | 2915390090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 6,7-Epoxy-3,7-dimethyl-2-octene1-ol acetate |
| epoxygeranyl acetate |
| trans-6,7-epoxy-3,7-dimethyl-2-octenyl acetate |