2-[1-(2-hydroxy-3,5-dimethylphenyl)propyl]-4,6-dimethylphenol structure
|
Common Name | 2-[1-(2-hydroxy-3,5-dimethylphenyl)propyl]-4,6-dimethylphenol | ||
|---|---|---|---|---|
| CAS Number | 3772-20-1 | Molecular Weight | 284.39300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[1-(2-hydroxy-3,5-dimethylphenyl)propyl]-4,6-dimethylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24O2 |
|---|---|
| Molecular Weight | 284.39300 |
| Exact Mass | 284.17800 |
| PSA | 40.46000 |
| LogP | 4.87330 |
| InChIKey | ORXGGTMEDSCSGI-UHFFFAOYSA-N |
| SMILES | CCC(c1cc(C)cc(C)c1O)c1cc(C)cc(C)c1O |
| HS Code | 2907299090 |
|---|
|
~3%
2-[1-(2-hydroxy... CAS#:3772-20-1 |
| Literature: Yamada; Nishiyama; Yamamoto; Tanaka Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 11 p. 3603 - 3608 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 1,1-Bis-(2-hydroxy-3,5-dimethyl-phenyl)-propan |
| Phenol,2,2'-propylidenebis[4,6-dimethyl |
| 2,2'-propylidenebis(4,6-dimethylphenol) |
| 1,1-bis(2-hydroxy-3,5-dimethylphenyl)propane |