ethyl 5-(4-ethoxycarbonylbutyl-ethyl-amino)pentanoate structure
|
Common Name | ethyl 5-(4-ethoxycarbonylbutyl-ethyl-amino)pentanoate | ||
|---|---|---|---|---|
| CAS Number | 37739-71-2 | Molecular Weight | 301.42200 | |
| Density | 0.982g/cm3 | Boiling Point | 364.7ºC at 760 mmHg | |
| Molecular Formula | C16H31NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.4ºC | |
| Name | ethyl 5-[(5-ethoxy-5-oxopentyl)-ethylamino]pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.982g/cm3 |
|---|---|
| Boiling Point | 364.7ºC at 760 mmHg |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.42200 |
| Flash Point | 174.4ºC |
| Exact Mass | 301.22500 |
| PSA | 55.84000 |
| LogP | 2.77510 |
| Index of Refraction | 1.456 |
| InChIKey | QKAZSQGIMOBQGD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCN(CC)CCCCC(=O)OCC |
|
~%
ethyl 5-(4-etho... CAS#:37739-71-2 |
| Literature: Leonard et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 5708,5711 |
|
~%
ethyl 5-(4-etho... CAS#:37739-71-2 |
| Literature: Leonard et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 5708,5711 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5,5'-ethylimino-di-valeric acid diethyl ester |
| 5,5'-Aethylimino-di-valeriansaeure-diaethylester |