1-[(4-methylphenyl)methyl]benzimidazol-2-amine structure
|
Common Name | 1-[(4-methylphenyl)methyl]benzimidazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 37743-74-1 | Molecular Weight | 237.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(4-methylphenyl)methyl]benzimidazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15N3 |
|---|---|
| Molecular Weight | 237.30000 |
| Exact Mass | 237.12700 |
| PSA | 44.57000 |
| LogP | 2.90530 |
| InChIKey | HUXAXCIUQJSPOG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cn2c(N)nc3ccccc32)cc1 |
|
~28%
1-[(4-methylphe... CAS#:37743-74-1 |
| Literature: Vlaovic, Djordje; Canadanovic-Brunet, Jasna; Balaz, Jelica; Juranic, Ivan; Djokovic, Dejan; Mackenzie, Kenneth Bioscience, Biotechnology, and Biochemistry, 1992 , vol. 56, # 2.3.4. p. 199 - 206 |
|
~%
1-[(4-methylphe... CAS#:37743-74-1 |
| Literature: Ramstroem, Helena; Bourotte, Maryline; Philippe, Claude; Schmitt, Martine; Haiech, Jacques; Bourguignon, Jean-Jacques Journal of Medicinal Chemistry, 2004 , vol. 47, # 9 p. 2264 - 2275 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-amino-1-(4-methylbenzyl)benzimidazole |
| 1-(4-methylbenzyl)-1h-benzoimidazol-2-ylamine |