bis[(5-chloropyridin-3-yl)methyl] hexanedioate
Modify Date: 2025-09-14 05:58:13
![bis[(5-chloropyridin-3-yl)methyl] hexanedioate Structure](https://image.chemsrc.com/caspic/477/37744-47-1.png)
bis[(5-chloropyridin-3-yl)methyl] hexanedioate structure
|
Common Name | bis[(5-chloropyridin-3-yl)methyl] hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 37744-47-1 | Molecular Weight | 397.25300 | |
| Density | 1.327g/cm3 | Boiling Point | 508.2ºC at 760 mmHg | |
| Molecular Formula | C18H18Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.2ºC | |
| Name | bis[(5-chloropyridin-3-yl)methyl] hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 508.2ºC at 760 mmHg |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.25300 |
| Flash Point | 261.2ºC |
| Exact Mass | 396.06400 |
| PSA | 78.38000 |
| LogP | 4.13040 |
| Index of Refraction | 1.565 |
| InChIKey | OVYJJSSBRLTNQS-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC(=O)OCc1cncc(Cl)c1)OCc1cncc(Cl)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Bis((5-chloro-3-pyridinyl)methyl) hexanedioate |
| Hexanedioic acid,bis((5-chloro-3-pyridinyl)methyl) ester |