2-diethoxyphosphinothioylsulfanyl-N,N-dipropyl-acetamide
Modify Date: 2025-08-25 21:28:19
2-diethoxyphosphinothioylsulfanyl-N,N-dipropyl-acetamide structure
|
Common Name | 2-diethoxyphosphinothioylsulfanyl-N,N-dipropyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 37744-82-4 | Molecular Weight | 327.44400 | |
| Density | 1.13g/cm3 | Boiling Point | 396.1ºC at 760mmHg | |
| Molecular Formula | C12H26NO3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.3ºC | |
| Name | 2-diethoxyphosphinothioylsulfanyl-N,N-dipropylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 396.1ºC at 760mmHg |
| Molecular Formula | C12H26NO3PS2 |
| Molecular Weight | 327.44400 |
| Flash Point | 193.3ºC |
| Exact Mass | 327.10900 |
| PSA | 105.97000 |
| LogP | 4.31630 |
| Index of Refraction | 1.512 |
| InChIKey | GMSYPEMNQYZMHO-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)CSP(=S)(OCC)OCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphorodithioic acid,O,O-diethyl S-(2-(dipropylamino)-2-oxoethyl) ester |
| O,O-Diethyl S-(N,N-di-n-propylcarbamoylmethyl) phosphorodithioate |
| s-[2-(dipropylamino)-2-oxoethyl] o,o-diethyl phosphorodithioate |