(5E)-5-benzylideneimidazolidine-2,4-dione structure
|
Common Name | (5E)-5-benzylideneimidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 3775-01-7 | Molecular Weight | 188.18300 | |
| Density | 1.329g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-benzylidenehydantoin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18300 |
| Exact Mass | 188.05900 |
| PSA | 58.20000 |
| LogP | 1.52450 |
| Index of Refraction | 1.646 |
| InChIKey | UDTSPKADQGPZFS-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(=Cc2ccccc2)N1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Di-iso-propoxy-phenyl-methylsilan |
| diisopropoxy-methyl-phenyl-silane |
| Diisopropyloxy-methyl-phenyl-silan |
| 5-benzylideneimidazolidine-2,4-dione |
| phenylmethyldiisopropyloxysilane |
| 5-benzylidenehydantoine |
| phenylmethylene hydantoin |