(+)3σ-N-Phenylethylaminobuttersaeure
Modify Date: 2026-07-01 20:08:01
(+)3σ-N-Phenylethylaminobuttersaeure structure
|
Common Name | (+)3σ-N-Phenylethylaminobuttersaeure | ||
|---|---|---|---|---|
| CAS Number | 3775-69-7 | Molecular Weight | 207.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (+)3σ-N-Phenylethylaminobuttersaeure |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17NO2 |
|---|---|
| Molecular Weight | 207.26900 |
| Exact Mass | 207.12600 |
| PSA | 49.33000 |
| LogP | 2.59130 |
| InChIKey | HMITUJGNRCASQV-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)NC(C)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:2835-82-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (+)3σ-N-Phenylethylaminobuttersaeure? |
| A: LogP of (+)3σ-N-Phenylethylaminobuttersaeure is 2.59130. |
| Q: What is the molecular formula of (+)3σ-N-Phenylethylaminobuttersaeure? |
| A: Molecular formula of (+)3σ-N-Phenylethylaminobuttersaeure is C12H17NO2. |
| Q: What is the SMILES notation of (+)3σ-N-Phenylethylaminobuttersaeure? |
| A: SMILES notation of (+)3σ-N-Phenylethylaminobuttersaeure is CC(CC(=O)O)NC(C)c1ccccc1. |
| Q: What is the molecular weight of (+)3σ-N-Phenylethylaminobuttersaeure? |
| A: Molecular weight of (+)3σ-N-Phenylethylaminobuttersaeure is 207.26900. |
| Q: What is the CAS number of (+)3σ-N-Phenylethylaminobuttersaeure? |
| A: CAS number of (+)3σ-N-Phenylethylaminobuttersaeure is 3775-69-7. |
| Q: What is the Chinese name of 3775-69-7? |
| A: Chinese name of 3775-69-7 is 3775-69-7. |
| Q: What is the English name of (+)3σ-N-Phenylethylaminobuttersaeure? |
| A: The English name of (+)3σ-N-Phenylethylaminobuttersaeure is (+)3σ-N-Phenylethylaminobuttersaeure. |
| Q: What are the downstream products of (+)3σ-N-Phenylethylaminobuttersaeure? |
| A: Related downstream products(CAS) of (+)3σ-N-Phenylethylaminobuttersaeure: 2835-82-7. |
| Q: What is the polar surface area (PSA) of (+)3σ-N-Phenylethylaminobuttersaeure? |
| A: Polar surface area (PSA) of (+)3σ-N-Phenylethylaminobuttersaeure is 49.33000. |
| Q: What is the InChIKey of (+)3σ-N-Phenylethylaminobuttersaeure? |
| A: InChIKey of (+)3σ-N-Phenylethylaminobuttersaeure is HMITUJGNRCASQV-UHFFFAOYSA-N. |