2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate
2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate structure
|
Common Name | 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 37787-77-2 | Molecular Weight | 305.36900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H23NO4 |
|---|---|
| Molecular Weight | 305.36900 |
| Exact Mass | 305.16300 |
| PSA | 55.84000 |
| LogP | 3.06720 |
| InChIKey | DFBLOFPQNCBVTI-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)OCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:16652-71-4
CAS#:41324-66-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Boc-L-proline benzyl ester |
| (S)-1-tert-butyl benzyl pyrrolidine-1,2-dicarboxylate |
| (S)-1-tert-butyl-2-benzyl-pyrrolidine-1,2-dicarboxylate |
| Boc-Pro-OBzl |
| 2-benzyl (S)-1-tert-butyl pyrrolidine-1,2-dicarboxylate |
| N-Boc-L-proline benzyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate? |
| A: Polar surface area (PSA) of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate is 55.84000. |
| Q: What is the English name of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate? |
| A: The English name of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate is 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate. |
| Q: What is the molecular weight of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate? |
| A: Molecular weight of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate is 305.36900. |
| Q: What is the molecular formula of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate? |
| A: Molecular formula of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate is C17H23NO4. |
| Q: What is the SMILES notation of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate? |
| A: SMILES notation of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate is CC(C)(C)OC(=O)N1CCCC1C(=O)OCc1ccccc1. |
| Q: What is the CAS number of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate? |
| A: CAS number of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate is 37787-77-2. |
| Q: What is the LogP of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate? |
| A: LogP of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate is 3.06720. |
| Q: What are the downstream products of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate? |
| A: Related downstream products(CAS) of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate: 16652-71-4;41324-66-7. |
| Q: What is the InChIKey of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate? |
| A: InChIKey of 2-benzyl 1-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate is DFBLOFPQNCBVTI-AWEZNQCLSA-N. |
| Q: What is the Chinese name of 37787-77-2? |
| A: Chinese name of 37787-77-2 is 37787-77-2. |