1,1,5,5-tetraethyl pentane-1,1,5,5-tetracarboxylate structure
|
Common Name | 1,1,5,5-tetraethyl pentane-1,1,5,5-tetracarboxylate | ||
|---|---|---|---|---|
| CAS Number | 3779-30-4 | Molecular Weight | 360.39900 | |
| Density | 1.112g/cm3 | Boiling Point | 392.7ºC at 760 mmHg | |
| Molecular Formula | C17H28O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.5ºC | |
| Name | tetraethyl pentane-1,1,5,5-tetracarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 392.7ºC at 760 mmHg |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.39900 |
| Flash Point | 166.5ºC |
| Exact Mass | 360.17800 |
| PSA | 105.20000 |
| LogP | 1.64150 |
| Index of Refraction | 1.454 |
| InChIKey | HKZYXKOJTRUQHY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCCC(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Pentan-1,1,5,5-tetracarbonsaeure-tetraaethylester |
| 1,1,5,5-tetraethoxycarbonylpentane |
| tetraethyl propylenebismalonate |
| Pentan-1,1,5,5-tetracarbonsaeure-tetraethylester |
| 1,1,5,5-Pentantetracarbonsaeure-tetraethylester |
| pentane-1,1,5,5-tetracarboxylic acid tetraethyl ester |
| Tetraethyl 1,1,5,5-pentanetetracarboxylate |