METHYL 2-[(3-CHLOROPROPANOYL)AMINO]BENZOATE
![METHYL 2-[(3-CHLOROPROPANOYL)AMINO]BENZOATE Structure](https://image.chemsrc.com/caspic/157/37795-76-9.png)
METHYL 2-[(3-CHLOROPROPANOYL)AMINO]BENZOATE structure
|
Common Name | METHYL 2-[(3-CHLOROPROPANOYL)AMINO]BENZOATE | ||
|---|---|---|---|---|
| CAS Number | 37795-76-9 | Molecular Weight | 241.67100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-(3-chloropropanoylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12ClNO3 |
|---|---|
| Molecular Weight | 241.67100 |
| Exact Mass | 241.05100 |
| PSA | 58.89000 |
| LogP | 2.69010 |
| InChIKey | OWAOXUCRJSRPHS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)CCCl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
METHYL 2-[(3-CH... CAS#:37795-76-9 |
| Literature: Reisner; Ludwig; Simon; Dejneka; Sofia Arzneimittel-Forschung/Drug Research, 1977 , vol. 27, # 4 p. 766 - 770 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(3-Chlorpropionamido)benzoesaeuremethylester |
| methyl 2-(3-chloropropanamido)benzoate |
| 2-(3-chloro-propionylamino)-benzoic acid methyl ester |
| methyl 2-[(3-chloropropanoyl)amino]benzoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of methyl 2-(3-chloropropanoylamino)benzoate? |
| A: Polar surface area (PSA) of methyl 2-(3-chloropropanoylamino)benzoate is 58.89000. |
| Q: What is the English name of methyl 2-(3-chloropropanoylamino)benzoate? |
| A: The English name of methyl 2-(3-chloropropanoylamino)benzoate is methyl 2-(3-chloropropanoylamino)benzoate. |
| Q: What is the LogP of methyl 2-(3-chloropropanoylamino)benzoate? |
| A: LogP of methyl 2-(3-chloropropanoylamino)benzoate is 2.69010. |
| Q: What is the CAS number of methyl 2-(3-chloropropanoylamino)benzoate? |
| A: CAS number of methyl 2-(3-chloropropanoylamino)benzoate is 37795-76-9. |
| Q: What English synonyms does methyl 2-(3-chloropropanoylamino)benzoate have? |
| A: English synonyms of methyl 2-(3-chloropropanoylamino)benzoate: 2-(3-Chlorpropionamido)benzoesaeuremethylester, methyl 2-(3-chloropropanamido)benzoate, 2-(3-chloro-propionylamino)-benzoic acid methyl ester, methyl 2-[(3-chloropropanoyl)amino]benzoate. |
| Q: What is the InChIKey of methyl 2-(3-chloropropanoylamino)benzoate? |
| A: InChIKey of methyl 2-(3-chloropropanoylamino)benzoate is OWAOXUCRJSRPHS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of methyl 2-(3-chloropropanoylamino)benzoate? |
| A: Molecular weight of methyl 2-(3-chloropropanoylamino)benzoate is 241.67100. |
| Q: What is the SMILES notation of methyl 2-(3-chloropropanoylamino)benzoate? |
| A: SMILES notation of methyl 2-(3-chloropropanoylamino)benzoate is COC(=O)c1ccccc1NC(=O)CCCl. |
| Q: What is the Chinese name of 37795-76-9? |
| A: Chinese name of 37795-76-9 is 37795-76-9. |
| Q: What is the molecular formula of methyl 2-(3-chloropropanoylamino)benzoate? |
| A: Molecular formula of methyl 2-(3-chloropropanoylamino)benzoate is C11H12ClNO3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |