2-Propenoic acid, 2-methyl-, 4-(acetylamino)phenyl ester structure
|
Common Name | 2-Propenoic acid, 2-methyl-, 4-(acetylamino)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 37796-01-3 | Molecular Weight | 219.23700 | |
| Density | 1.165g/cm3 | Boiling Point | 418.7ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207ºC | |
| Name | (4-acetamidophenyl) 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 418.7ºC at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 207ºC |
| Exact Mass | 219.09000 |
| PSA | 58.89000 |
| LogP | 2.77600 |
| Index of Refraction | 1.558 |
| InChIKey | PZJZQKCKFRXTMP-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Oc1ccc(NC(C)=O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Poly(4-methacryloylacetanilide) |
| 2-Propenoic acid,2-methyl-,4-(acetylamino)phenyl ester |
| 4-(Acetylamino)phenyl 2-methyl-2-propenoate homopolymer |
| 2-Propenoic acid,2-methyl-,4-(acetylamino)phenyl ester,homopolymer |
| 4-(Acetylamino)phenyl 2-methyl-2-propenoate |
| 4-methacryloyl-oxyacetanilide |
| T0501-8448 |