bis[4-(chloromethyl)phenyl]diazene structure
|
Common Name | bis[4-(chloromethyl)phenyl]diazene | ||
|---|---|---|---|---|
| CAS Number | 37797-32-3 | Molecular Weight | 279.16400 | |
| Density | 1.21g/cm3 | Boiling Point | 436.5ºC at 760 mmHg | |
| Molecular Formula | C14H12Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.8ºC | |
| Name | bis[4-(chloromethyl)phenyl]diazene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 436.5ºC at 760 mmHg |
| Molecular Formula | C14H12Cl2N2 |
| Molecular Weight | 279.16400 |
| Flash Point | 217.8ºC |
| Exact Mass | 278.03800 |
| PSA | 24.72000 |
| LogP | 5.57960 |
| Index of Refraction | 1.589 |
| InChIKey | PPJWGGJENAIQSR-UHFFFAOYSA-N |
| SMILES | ClCc1ccc(N=Nc2ccc(CCl)cc2)cc1 |
|
~%
bis[4-(chlorome... CAS#:37797-32-3 |
| Literature: Shinkai, Seiji; Shigematsu, Kazuyoshi; Kusano, Yumiko; Manabe, Osamu Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 3279 - 3283 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,4'-bis(chloromethyl)azobenzene |
| 4,4'-Azobenzylchlorid |
| Bis(4-(chloromethyl)phenyl)diazene |
| Diazene,bis(4-(chloromethyl)phenyl) |