2,2,3,3-tetrafluoro-3-(heptafluoropropoxy)propionic acid structure
|
Common Name | 2,2,3,3-tetrafluoro-3-(heptafluoropropoxy)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 378-03-0 | Molecular Weight | 330.05300 | |
| Density | 1.748g/cm3 | Boiling Point | 167.5ºC at 760mmHg | |
| Molecular Formula | C6HF11O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 55.1ºC | |
| Name | 2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.748g/cm3 |
|---|---|
| Boiling Point | 167.5ºC at 760mmHg |
| Molecular Formula | C6HF11O3 |
| Molecular Weight | 330.05300 |
| Flash Point | 55.1ºC |
| Exact Mass | 329.97500 |
| PSA | 46.53000 |
| LogP | 3.10610 |
| Index of Refraction | 1.295 |
| InChIKey | MPQDGDVBZJSJIA-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2918990090 |
|---|
|
~29%
2,2,3,3-tetrafl... CAS#:378-03-0 |
| Literature: DUPONT PERFORMANCE ELASTOMERS L.L.C. Patent: WO2009/61999 A1, 2009 ; Location in patent: Page/Page column 11 ; |
|
~%
2,2,3,3-tetrafl... CAS#:378-03-0 |
| Literature: Minnesota Mining and Mfg. Co. Patent: US2713593 , 1953 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tetrafluoro-3-(heptafluoro-propoxy)-propionic acid |
| EINECS 206-822-8 |
| C3F7OCF2CF2COOH |
| 2,2,3,3-tetrafluoro-3-(heptafluoropropoxy)propionic acid |
| Propionic acid,2,2,3,3-tetrafluoro-3-(heptafluoropropoxy)-(8CI) |
| CF3CF2CF2OCF2CF2COOH |
| Propanoic acid,2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3,3-heptafluoropropoxy) |
| Propanoicacid,2,2,3,3-tetrafluoro-3-(heptafluoropropoxy)-(9CI) |
| Tetrafluor-3-(heptafluor-propoxy)-propionsaeure |