21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion
Modify Date: 2026-08-03 11:02:21
21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion structure
|
Common Name | 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion | ||
|---|---|---|---|---|
| CAS Number | 378-35-8 | Molecular Weight | 577.38500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28BrF3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H28BrF3O7 |
|---|---|
| Molecular Weight | 577.38500 |
| Exact Mass | 576.09700 |
| PSA | 106.97000 |
| LogP | 3.75910 |
| InChIKey | HQLIVNXKDQKLOG-ULKZCYFGSA-N |
| SMILES | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)C=CC4(C)C3(Br)C(OC(=O)C(F)(F)F)CC21C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:38680-83-0This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion? |
| A: Related downstream products(CAS) of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion: 38680-83-0. |
| Q: What is the Chinese name of 378-35-8? |
| A: Chinese name of 378-35-8 is 378-35-8. |
| Q: What is the InChIKey of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion? |
| A: InChIKey of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion is HQLIVNXKDQKLOG-ULKZCYFGSA-N. |
| Q: What is the molecular formula of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion? |
| A: Molecular formula of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion is C25H28BrF3O7. |
| Q: What is the LogP of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion? |
| A: LogP of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion is 3.75910. |
| Q: What is the polar surface area (PSA) of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion? |
| A: Polar surface area (PSA) of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion is 106.97000. |
| Q: What is the CAS number of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion? |
| A: CAS number of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion is 378-35-8. |
| Q: What is the English name of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion? |
| A: The English name of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion is 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion. |
| Q: What is the molecular weight of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion? |
| A: Molecular weight of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion is 577.38500. |
| Q: What is the SMILES notation of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion? |
| A: SMILES notation of 21-Acetoxy-9α-brom-11β-trifluoracetoxy-17α-hydroxy-pregna-1,4-dien-3,20-dion is CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)C=CC4(C)C3(Br)C(OC(=O)C(F)(F)F)CC21C. |