potassium pentafluoropropionate structure
|
Common Name | potassium pentafluoropropionate | ||
|---|---|---|---|---|
| CAS Number | 378-76-7 | Molecular Weight | 202.12100 | |
| Density | N/A | Boiling Point | 93.5ºC at 760 mmHg | |
| Molecular Formula | C3F5KO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 10.3ºC | |
| Name | potassium,2,2,3,3,3-pentafluoropropanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 93.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C3F5KO2 |
| Molecular Weight | 202.12100 |
| Flash Point | 10.3ºC |
| Exact Mass | 201.94600 |
| PSA | 40.13000 |
| InChIKey | AHGFDQXBCIASJK-UHFFFAOYSA-M |
| SMILES | O=C([O-])C(F)(F)C(F)(F)F.[K+] |
| HS Code | 2915900090 |
|---|
|
~%
potassium penta... CAS#:378-76-7 |
| Literature: ARRAY BIOPHARMA, INC. Patent: WO2007/24612 A2, 2007 ; Location in patent: Page/Page column 30 ; |
|
~94%
potassium penta... CAS#:378-76-7 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4723016 A1, 1988 ; |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Potassium perfluoropropionate |
| potassium 2,2,3,3,3-pentafluoropropanoate |
| Potassium pentafluoropropionate |
| Propanoic acid,pentafluoro-,potassium salt |
| EINECS 206-829-6 |
| potassium pentafluoropropanoate |