1-[4-(trifluoromethyl)phenyl]butan-1-one structure
|
Common Name | 1-[4-(trifluoromethyl)phenyl]butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 37851-10-8 | Molecular Weight | 216.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-(trifluoromethyl)phenyl]butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11F3O |
|---|---|
| Molecular Weight | 216.20000 |
| Exact Mass | 216.07600 |
| PSA | 17.07000 |
| LogP | 3.68820 |
| InChIKey | BULGSEUYSPGOCC-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1ccc(C(F)(F)F)cc1 |
| HS Code | 2914700090 |
|---|
|
~92%
1-[4-(trifluoro... CAS#:37851-10-8 |
| Literature: Gnanadesikan, Vijay; Horiuchi, Yoshihiro; Ohshima, Takashi; Shibasaki, Masakatsu Journal of the American Chemical Society, 2004 , vol. 126, # 25 p. 7782 - 7783 |
|
~%
1-[4-(trifluoro... CAS#:37851-10-8 |
| Literature: MERCK SHARP and DOHME LIMITED Patent: WO2005/13985 A1, 2005 ; Location in patent: Page/Page column 55 ; WO 2005/013985 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-Butanone,1-[4-(trifluoromethyl)phenyl] |
| 1-(4-trifluoromethylphenyl)butan-1-one |
| 1-(4-trifluoromethylphenyl)butane-1-one |