4-[Ethyl[2,4,6-triiodo-3-(methylamino)phenyl]amino]-4-oxobutyric acid structure
|
Common Name | 4-[Ethyl[2,4,6-triiodo-3-(methylamino)phenyl]amino]-4-oxobutyric acid | ||
|---|---|---|---|---|
| CAS Number | 37863-70-0 | Molecular Weight | 627.98300 | |
| Density | 2.318g/cm3 | Boiling Point | 657.7ºC at 760 mmHg | |
| Molecular Formula | C13H15I3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.6ºC | |
| Name | 4-[N-ethyl-2,4,6-triiodo-3-(methylamino)anilino]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.318g/cm3 |
|---|---|
| Boiling Point | 657.7ºC at 760 mmHg |
| Molecular Formula | C13H15I3N2O3 |
| Molecular Weight | 627.98300 |
| Flash Point | 351.6ºC |
| Exact Mass | 627.82200 |
| PSA | 69.64000 |
| LogP | 3.83280 |
| Index of Refraction | 1.738 |
| InChIKey | IGSPYLOKMDUVEX-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)CCC(=O)O)c1c(I)cc(I)c(NC)c1I |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acidum iosumeticum |
| Iosumetic acid |
| Acido iosumetico |
| 4-{ethyl[2,4,6-triiodo-3-(methylamino)phenyl]amino}-4-oxobutanoic acid |
| Iosumetic acid (USAN/INN) |
| Acide iosumetique |