1-methyl-4-(phenylsulfanylmethylsulfonyl)benzene structure
|
Common Name | 1-methyl-4-(phenylsulfanylmethylsulfonyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 37891-98-8 | Molecular Weight | 278.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-(phenylsulfanylmethylsulfonyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14O2S2 |
|---|---|
| Molecular Weight | 278.39000 |
| Exact Mass | 278.04400 |
| PSA | 67.82000 |
| LogP | 4.59930 |
| InChIKey | VPWKXFANSASFBQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CSc2ccccc2)cc1 |
|
~%
1-methyl-4-(phe... CAS#:37891-98-8 |
| Literature: Zhdankin; Erickson; Hanson Journal of the American Chemical Society, 1997 , vol. 119, # 20 p. 4775 - 4776 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzene,1-methyl-4-[[(phenylthio)methyl]sulfonyl] |
| phenylthiomethyl para-tolylsulphone |