1-Propanone,1-(2-hydroxy-4,6-dimethoxyphenyl)- 3-phenyl-
Modify Date: 2025-09-16 17:30:38
1-Propanone,1-(2-hydroxy-4,6-dimethoxyphenyl)- 3-phenyl- structure
|
Common Name | 1-Propanone,1-(2-hydroxy-4,6-dimethoxyphenyl)- 3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 3791-76-2 | Molecular Weight | 286.32200 | |
| Density | 1.17g/cm3 | Boiling Point | 479.1ºC at 760 mmHg | |
| Molecular Formula | C17H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.8ºC | |
| Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760 mmHg |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32200 |
| Flash Point | 175.8ºC |
| Exact Mass | 286.12100 |
| PSA | 55.76000 |
| LogP | 3.22490 |
| Index of Refraction | 1.573 |
| InChIKey | JAJFQMZJIQDRSX-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(C(=O)CCc2ccccc2)c(OC)c1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| dihydroflavokawain b |
| 2',4'-dimethoxy-6'-hydroxy-3-phenyl-propiophenone |
| Dihydroflavokawin B |
| 2'-hydroxy-4',6'-dimethoxydihydrochalcone |