1,2,3-trichloro-4-[(E)-2-chloro-1-dimethoxyphosphoryloxy-ethenyl]benze ne structure
|
Common Name | 1,2,3-trichloro-4-[(E)-2-chloro-1-dimethoxyphosphoryloxy-ethenyl]benze ne | ||
|---|---|---|---|---|
| CAS Number | 37913-85-2 | Molecular Weight | 365.96200 | |
| Density | 1.52g/cm3 | Boiling Point | 403.1ºC at 760mmHg | |
| Molecular Formula | C10H9Cl4O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.5ºC | |
| Name | [2-chloro-1-(2,3,4-trichlorophenyl)ethenyl] dimethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 403.1ºC at 760mmHg |
| Molecular Formula | C10H9Cl4O4P |
| Molecular Weight | 365.96200 |
| Flash Point | 307.5ºC |
| Exact Mass | 363.89900 |
| PSA | 54.57000 |
| LogP | 5.60150 |
| Index of Refraction | 1.553 |
| InChIKey | CKRKMPZQCMAKGJ-VMPITWQZSA-N |
| SMILES | COP(=O)(OC)OC(=CCl)c1ccc(Cl)c(Cl)c1Cl |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| SD 8857 |
| 1,2,3-TRICHLORO-4-[(E)-2-CHLORO-1-DIMETHOXYPHOSPHORYLOXY-ETHENYL]BENZENE |
| Phosphoric acid,2-chloro-1-(2,3,4-trichlorophenyl)ethenyl dimethyl ester |
| Phosphoricacid,2-chloro-1-(2,3,4-trichlorophenyl)vinyl dimethyl ester (7CI) |