5-{[2-(5-Methylthiophen-2-yl)-2-oxoethyl]sulfanyl}-4-phenyl-8-thia-4,6-diazatricyclo[7.4.0.0^{2,7}]trideca-1(9),2(7),5-trien-3-one structure
|
Common Name | 5-{[2-(5-Methylthiophen-2-yl)-2-oxoethyl]sulfanyl}-4-phenyl-8-thia-4,6-diazatricyclo[7.4.0.0^{2,7}]trideca-1(9),2(7),5-trien-3-one | ||
|---|---|---|---|---|
| CAS Number | 379239-33-5 | Molecular Weight | 452.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H20N2O2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-{[2-(5-Methylthiophen-2-yl)-2-oxoethyl]sulfanyl}-4-phenyl-8-thia-4,6-diazatricyclo[7.4.0.0^{2,7}]trideca-1(9),2(7),5-trien-3-one |
|---|
| Molecular Formula | C23H20N2O2S3 |
|---|---|
| Molecular Weight | 452.6 |
| InChIKey | ONMZCVLKPWKYSW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C(=O)CSC2=NC3=C(C4=C(S3)CCCC4)C(=O)N2C5=CC=CC=C5 |
|
Name: Inhibition of PRC2 EZH2 sub unit (unknown origin) assessed as inhibition of SAM-media...
Source: ChEMBL
Target: Histone-lysine N-methyltransferase EZH2
External Id: CHEMBL3826279
|