Crustacean Erythrophore Concentrating Hormone structure
|
Common Name | Crustacean Erythrophore Concentrating Hormone | ||
|---|---|---|---|---|
| CAS Number | 37933-92-9 | Molecular Weight | 930.01700 | |
| Density | 1.36g/cm3 | Boiling Point | 1517ºC at 760mmHg | |
| Molecular Formula | C45H59N11O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 871.3ºC | |
Use of Crustacean Erythrophore Concentrating HormoneRed pigment-concentrating hormone is a chromatophorotropic hormone and is synthesized in the eyestalk. Red pigment-concentrating hormone may plays a role as a downstream hormone of 5-HT[1]. |
| Name | 5-Oxo-L-prolyl-L-leucyl-L-asparaginyl-L-phenylalanyl-L-seryl-L-pr olylglycyl-L-tryptophanamide |
|---|
| Description | Red pigment-concentrating hormone is a chromatophorotropic hormone and is synthesized in the eyestalk. Red pigment-concentrating hormone may plays a role as a downstream hormone of 5-HT[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 1517ºC at 760mmHg |
| Molecular Formula | C45H59N11O11 |
| Molecular Weight | 930.01700 |
| Flash Point | 871.3ºC |
| Exact Mass | 929.44000 |
| PSA | 372.62000 |
| LogP | 4.71700 |
| Index of Refraction | 1.618 |
| InChIKey | XFGMPZRFMGBTDI-POFDKVPJSA-N |
| SMILES | CC(C)CC(NC(=O)C1CCC(=O)N1)C(=O)NC(CC(N)=O)C(=O)NC(Cc1ccccc1)C(=O)NC(CO)C(=O)N1CCCC1C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(N)=O |