Butanoic acid, 4-oxo-4-(propyl(2,4,6-triiodo-3-methoxyphenyl)amino)- ( 9CI)
Modify Date: 2025-08-21 18:17:09
Butanoic acid, 4-oxo-4-(propyl(2,4,6-triiodo-3-methoxyphenyl)amino)- ( 9CI) structure
|
Common Name | Butanoic acid, 4-oxo-4-(propyl(2,4,6-triiodo-3-methoxyphenyl)amino)- ( 9CI) | ||
|---|---|---|---|---|
| CAS Number | 37938-78-6 | Molecular Weight | 642.99500 | |
| Density | 2.202g/cm3 | Boiling Point | 634.8ºC at 760mmHg | |
| Molecular Formula | C14H16I3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.7ºC | |
| Name | 4-oxo-4-(2,4,6-triiodo-3-methoxy-N-propylanilino)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.202g/cm3 |
|---|---|
| Boiling Point | 634.8ºC at 760mmHg |
| Molecular Formula | C14H16I3NO4 |
| Molecular Weight | 642.99500 |
| Flash Point | 337.7ºC |
| Exact Mass | 642.82100 |
| PSA | 66.84000 |
| LogP | 4.11680 |
| Index of Refraction | 1.683 |
| InChIKey | INJFAIFVICOHIE-UHFFFAOYSA-N |
| SMILES | CCCN(C(=O)CCC(=O)O)c1c(I)cc(I)c(OC)c1I |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-Methoxy-N-propyl-2',4',6'-triiodosuccinanilic acid |
| 4-oxo-4-[propyl(2,4,6-triiodo-3-methoxyphenyl)amino]butanoic acid |
| Succinanilic acid,3'-methoxy-N-propyl-2',4',6'-triiodo |
| N-Propyl-N-(2,4,6-trijod-3-methoxyphenyl)-succinamidsaeure [German] |