5-(dimethylamino)-1-[7-[5-(dimethylamino)pentanoyl]-9H-xanthen-2-yl]pentan-1-one
Modify Date: 2025-09-14 23:16:02
![5-(dimethylamino)-1-[7-[5-(dimethylamino)pentanoyl]-9H-xanthen-2-yl]pentan-1-one Structure](https://image.chemsrc.com/caspic/088/37972-03-5.png)
5-(dimethylamino)-1-[7-[5-(dimethylamino)pentanoyl]-9H-xanthen-2-yl]pentan-1-one structure
|
Common Name | 5-(dimethylamino)-1-[7-[5-(dimethylamino)pentanoyl]-9H-xanthen-2-yl]pentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 37972-03-5 | Molecular Weight | 436.58600 | |
| Density | 1.092g/cm3 | Boiling Point | 579.1ºC at 760 mmHg | |
| Molecular Formula | C27H36N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.1ºC | |
| Name | 5-(dimethylamino)-1-[7-[5-(dimethylamino)pentanoyl]-9H-xanthen-2-yl]pentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 579.1ºC at 760 mmHg |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.58600 |
| Flash Point | 304.1ºC |
| Exact Mass | 436.27300 |
| PSA | 49.85000 |
| LogP | 5.21230 |
| Index of Refraction | 1.559 |
| InChIKey | IYHHYVDCCCZJOZ-UHFFFAOYSA-N |
| SMILES | CN(C)CCCCC(=O)c1ccc2c(c1)Cc1cc(C(=O)CCCCN(C)C)ccc1O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1'-(9H-Xanthene-2,7-diyl)bis(5-(dimethylamino)-1-pentanone) |
| 1-Pentanone,1,1'-(9H-xanthene-2,7-diyl)bis(5-(dimethylamino) |
| 1,1'-(9h-xanthene-2,7-diyl)bis[5-(dimethylamino)pentan-1-one] |