1,3-Propanedione,1-(4-methoxyphenyl)-3-(3-nitrophenyl) structure
|
Common Name | 1,3-Propanedione,1-(4-methoxyphenyl)-3-(3-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 37975-16-9 | Molecular Weight | 299.27800 | |
| Density | 1.285g/cm3 | Boiling Point | 485.9ºC at 760mmHg | |
| Molecular Formula | C16H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.5ºC | |
| Name | 1-(4-methoxyphenyl)-3-(3-nitrophenyl)propane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285g/cm3 |
|---|---|
| Boiling Point | 485.9ºC at 760mmHg |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.27800 |
| Flash Point | 212.5ºC |
| Exact Mass | 299.07900 |
| PSA | 89.19000 |
| LogP | 3.58230 |
| Index of Refraction | 1.595 |
| InChIKey | IGEZAWGTOAHSLD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
|
Name: Inhibition of rabbit muscle glycogen phosphorylase 1a assessed as release of phosphat...
Source: ChEMBL
Target: Glycogen phosphorylase, muscle form
External Id: CHEMBL1817502
|
|
Name: Inhibition of rabbit muscle glycogen phosphorylase 1a assessed as release of phosphat...
Source: ChEMBL
Target: Glycogen phosphorylase, muscle form
External Id: CHEMBL1817501
|
| 3-(p-Methoxyphenyl)-indazole |
| 1-(4-methoxy-phenyl)-3-(3-nitro-phenyl)-propane-1,3-dione |
| 3-(4-methoxyphenyl)-1-(3-nitrophenyl)propan-1,3-dione |
| 3-(4-Methoxy-phenyl)-1(2)H-indazol |
| 1-(3-nitrophenyl)-3-(4-methoxyphenyl)propane-1,3-dione |
| 2-<3-Nitro-phenyl>-4-<4-methoxy-phenyl>-dioxol-(1,3) |
| 3-(4-methoxy-phenyl)-1(2)H-indazole |
| 1-(4-Methoxy-phenyl)-3-(3-nitro-phenyl)-propan-1,3-dion |
| 3-(4-METHOXY-PHENYL)-1H-INDAZOLE |