dibutyl cyclohex-4-ene-1,2-dicarboxylate
Modify Date: 2025-09-27 00:57:06
dibutyl cyclohex-4-ene-1,2-dicarboxylate structure
|
Common Name | dibutyl cyclohex-4-ene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 37981-16-1 | Molecular Weight | 282.37500 | |
| Density | 1.03g/cm3 | Boiling Point | 358.1ºC at 760mmHg | |
| Molecular Formula | C16H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.5ºC | |
| Name | dibutyl cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 358.1ºC at 760mmHg |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.37500 |
| Flash Point | 168.5ºC |
| Exact Mass | 282.18300 |
| PSA | 52.60000 |
| LogP | 3.25540 |
| Index of Refraction | 1.473 |
| InChIKey | ANOXPYCDNXHEEE-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1CC=CCC1C(=O)OCCCC |
| HS Code | 2917209090 |
|---|
|
~74%
dibutyl cyclohe... CAS#:37981-16-1 |
| Literature: Finikova, Olga S.; Cheprakov, Andrei V.; Vinogradov, Sergei A. Journal of Organic Chemistry, 2005 , vol. 70, # 23 p. 9562 - 9572 |
|
~%
dibutyl cyclohe... CAS#:37981-16-1 |
| Literature: Petr. Chem. Corp. Patent: US1824068 , 1930 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| dibutyl 1,2,3,6-tetrahydrophthalate |
| EINECS 253-738-2 |
| di(n-butyl) 4-cyclohexene-1,2-dicarboxylate |
| Tetrahydrophthalsaeure-dibutylester |
| Cyclohex-4-en-1,2-dicarbonsaeure-dibutylester |
| cyclohex-4-ene-1,2-dicarboxylic acid dibutyl ester |
| 4-Cyclohexene-1,2-dicarboxylicacid,1,2-dibutyl ester |
| 4-Cyclohexene-1,2-dicarboxylicacid,dibutyl ester (6CI,7CI,9CI) |
| Dibutyl4-cyclohexene-1,2-dicarboxylate |