1,1,1-trichloro-2,2,4,4,4-pentafluorobutane
Modify Date: 2025-08-25 11:55:00
1,1,1-trichloro-2,2,4,4,4-pentafluorobutane structure
|
Common Name | 1,1,1-trichloro-2,2,4,4,4-pentafluorobutane | ||
|---|---|---|---|---|
| CAS Number | 380-63-2 | Molecular Weight | 251.41000 | |
| Density | 1.611g/cm3 | Boiling Point | 117.357ºC at 760 mmHg | |
| Molecular Formula | C4H2Cl3F5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 34.427ºC | |
| Name | 1,1,1-trichloro-2,2,4,4,4-pentafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.611g/cm3 |
|---|---|
| Boiling Point | 117.357ºC at 760 mmHg |
| Molecular Formula | C4H2Cl3F5 |
| Molecular Weight | 251.41000 |
| Flash Point | 34.427ºC |
| Exact Mass | 249.91400 |
| LogP | 3.94430 |
| Index of Refraction | 1.376 |
| InChIKey | PBTBFYFONKOINH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)CC(F)(F)C(Cl)(Cl)Cl |
| HS Code | 2903799090 |
|---|
|
~%
1,1,1-trichloro... CAS#:380-63-2 |
| Literature: Henne; Hinkamp; Zimmerschied Journal of the American Chemical Society, 1945 , vol. 67, p. 1908 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1,1-trichloro-2,2,4,4,4-pentafluoro-butane |
| 1,1,1,3,3-Pentafluoro-4,4,4-trichlorobutane |
| 2,2,4,4,4-Pentafluoro-1,1,1-trichlorobutane |
| PC6397 |
| 1,1,1-Trichlor-2,2,4,4,4-pentafluor-butan |