WAY-607152
Modify Date: 2024-04-03 14:22:41
WAY-607152 structure
|
Common Name | WAY-607152 | ||
|---|---|---|---|---|
| CAS Number | 380483-23-8 | Molecular Weight | 407.51 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 644.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H17N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.5±31.5 °C | |
Use of WAY-607152anti-hepatitis B activity |
| Name | WAY-607152 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 644.4±55.0 °C at 760 mmHg |
| Molecular Formula | C21H17N3O2S2 |
| Molecular Weight | 407.51 |
| Flash Point | 343.5±31.5 °C |
| Exact Mass | 407.076202 |
| LogP | 4.33 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.737 |
| InChIKey | BRQACAIKZKODJF-UHFFFAOYSA-N |
| SMILES | O=C1CSC(c2cn(-c3ccccc3)nc2-c2cccs2)N1Cc1ccco1 |
| 4-Thiazolidinone, 3-(2-furanylmethyl)-2-[1-phenyl-3-(2-thienyl)-1H-pyrazol-4-yl]- |
| 3-(2-Furylmethyl)-2-[1-phenyl-3-(2-thienyl)-1H-pyrazol-4-yl]-1,3-thiazolidin-4-one |