methyl 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-butyrate
Modify Date: 2025-10-01 18:24:32
![methyl 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-butyrate Structure](https://image.chemsrc.com/caspic/156/38049-29-5.png)
methyl 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-butyrate structure
|
Common Name | methyl 6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-butyrate | ||
|---|---|---|---|---|
| CAS Number | 38049-29-5 | Molecular Weight | 222.32300 | |
| Density | 0.985g/cm3 | Boiling Point | 288.4ºC at 760 mmHg | |
| Molecular Formula | C14H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104ºC | |
| Name | methyl 4-(6,6-dimethyl-4-bicyclo[3.1.1]hept-3-enyl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.985g/cm3 |
|---|---|
| Boiling Point | 288.4ºC at 760 mmHg |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.32300 |
| Flash Point | 104ºC |
| Exact Mass | 222.16200 |
| PSA | 26.30000 |
| LogP | 3.32210 |
| Index of Refraction | 1.481 |
| InChIKey | MBUKQPVDYQVJCI-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCC1=CCC2CC1C2(C)C |
| HS Code | 2916209090 |
|---|
|
~%
methyl 6,6-dime... CAS#:38049-29-5 |
| Literature: Laszlo, Pierre; Teston-Henry, Michelle Tetrahedron Letters, 1991 , vol. 32, # 31 p. 3837 - 3838 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-(7,7-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-butyric acid methyl ester |
| EINECS 253-757-6 |
| 2-Pinen-10-propionsaeure-methylester |
| Methyl 6,6-dimethylbicyclo(3.1.1)hept-2-ene-2-butyrate |