4-nitro-N-[(3-nitrophenyl)methylideneamino]aniline structure
|
Common Name | 4-nitro-N-[(3-nitrophenyl)methylideneamino]aniline | ||
|---|---|---|---|---|
| CAS Number | 3805-41-2 | Molecular Weight | 286.24300 | |
| Density | 1.39g/cm3 | Boiling Point | 481ºC at 760 mmHg | |
| Molecular Formula | C13H10N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.7ºC | |
| Name | 4-nitro-N-[(Z)-(3-nitrophenyl)methylideneamino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 481ºC at 760 mmHg |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.24300 |
| Flash Point | 244.7ºC |
| Exact Mass | 286.07000 |
| PSA | 116.03000 |
| LogP | 4.06840 |
| Index of Refraction | 1.649 |
| InChIKey | DUJGQCJQVKGBBA-ZROIWOOFSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2cccc([N+](=O)[O-])c2)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
4-nitro-N-[(3-n... CAS#:3805-41-2 |
| Literature: Hyde Chemische Berichte, 1899 , vol. 32, p. 1813 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-Nitro-benzaldehyd-2.4-dinitro-phenylhydrazon |
| m-nitrobenzaldehyde 2,4-dinitrophenylhydrazone |
| <m-Nitrobenzaldehyd>-2.4-dinitrophenylhydrazon |
| m-Nitro-benzaldehyd-p-nitrophenylhydrazon |