[(E)-1-[3-(trifluoromethyl)phenyl]propan-2-ylideneamino] 3,4,5-trimethoxybenzoate structure
|
Common Name | [(E)-1-[3-(trifluoromethyl)phenyl]propan-2-ylideneamino] 3,4,5-trimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 38059-99-3 | Molecular Weight | 411.37200 | |
| Density | 1.225g/cm3 | Boiling Point | 492.002ºC at 760 mmHg | |
| Molecular Formula | C20H20F3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.354ºC | |
| Name | [(E)-1-[3-(trifluoromethyl)phenyl]propan-2-ylideneamino] 3,4,5-trimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 492.002ºC at 760 mmHg |
| Molecular Formula | C20H20F3NO5 |
| Molecular Weight | 411.37200 |
| Flash Point | 251.354ºC |
| Exact Mass | 411.12900 |
| PSA | 66.35000 |
| LogP | 4.50660 |
| Index of Refraction | 1.498 |
| InChIKey | IJJWZPPQNCLSQQ-WYMPLXKRSA-N |
| SMILES | COc1cc(C(=O)ON=C(C)Cc2cccc(C(F)(F)F)c2)cc(OC)c1OC |
| HS Code | 2928000090 |
|---|
|
~%
[(E)-1-[3-(trif... CAS#:38059-99-3 |
| Literature: Buzas,A. et al. Chimica Therapeutica, 1972 , vol. 7, p. 140 - 142 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Propanone,1-(3-(trifluoromethyl)phenyl)-,O-(3,4,5-trimethoxybenzoyl)oxime |
| (Trimethoxy-3,4,5-benzoyl)oxyimino m-(trifluoromethyl)benzylmethylcetone |
| 1-(3-(Trifluoromethyl)phenyl)-2-propanone O-(3,4,5-trimethoxybenzoyl)oxime |
| (Trimethoxy-3,4,5-benzoyl)oxyimino m-(trifluoromethyl)benzylmethylcetone [French] |