Acetophenone O-[(4-methylpiperazino)carbonylmethyl]oxime structure
|
Common Name | Acetophenone O-[(4-methylpiperazino)carbonylmethyl]oxime | ||
|---|---|---|---|---|
| CAS Number | 38063-86-4 | Molecular Weight | 275.34600 | |
| Density | 1.12g/cm3 | Boiling Point | 419.8ºC at 760 mmHg | |
| Molecular Formula | C15H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.7ºC | |
| Name | 1-(4-methylpiperazin-1-yl)-2-[(Z)-1-phenylethylideneamino]oxyethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 419.8ºC at 760 mmHg |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.34600 |
| Flash Point | 207.7ºC |
| Exact Mass | 275.16300 |
| PSA | 45.14000 |
| LogP | 1.07700 |
| Index of Refraction | 1.56 |
| InChIKey | QDULYSITXFAAKJ-SSZFMOIBSA-N |
| SMILES | CC(=NOCC(=O)N1CCN(C)CC1)c1ccccc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (Methylpiperazino-carboxymethyl) oxyimino acetophenone [French] |
| 1-methyl-4-[(1-phenyl-ethylideneaminooxy)-acetyl]-piperazine |
| ACETOPHENONE,O-((4-METHYL-1-PIPERAZINYL)CARBONYLMETHYL)OXIME |
| (Methylpiperazino-carboxymethyl) oxyimino acetophenone |