ethyl 2-amino-4-(2-ethoxy-2-oxoethyl)thiazole-5-carboxylate structure
|
Common Name | ethyl 2-amino-4-(2-ethoxy-2-oxoethyl)thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 38067-29-7 | Molecular Weight | 258.294 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 415.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.2±25.9 °C | |
| Name | Ethyl 2-amino-4-(2-ethoxy-2-oxoethyl)-1,3-thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 415.7±35.0 °C at 760 mmHg |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.294 |
| Flash Point | 205.2±25.9 °C |
| Exact Mass | 258.067413 |
| PSA | 120.48000 |
| LogP | 1.17 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | AOTIWZHONHECSJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1nc(N)sc1C(=O)OCC |
|
~90%
ethyl 2-amino-4... CAS#:38067-29-7 |
| Literature: Rangnekar, Dinesh W.; Kazemi, Gadhir J.; Malanker, Jayesh V.; Ramamurthy, Rajesh Phosphorus, Sulfur and Silicon and Related Elements, 1998 , vol. 141, p. 185 - 190 |
|
~%
ethyl 2-amino-4... CAS#:38067-29-7 |
| Literature: Sprague; Lincoln; Ziegler Journal of the American Chemical Society, 1946 , vol. 68, p. 268 |
| 6-Quinolinecarboxylic acid,2-amino-,ethyl ester |
| Ethyl 2-amino-4-(2-ethoxy-2-oxoethyl)-1,3-thiazole-5-carboxylate |
| 4-Thiazoleacetic acid, 2-amino-5-(ethoxycarbonyl)-, ethyl ester |
| 2-aminoquinoline-6-carboxylic acid ethyl ester |
| (5-Aethoxycarbonyl-2-amino-thiazol-4-yl)-essigsaeure-aethylester |
| (5-ethoxycarbonyl-2-amino-thiazol-4-yl)-acetic acid ethyl ester |
| ethyl 2-amino-4-(2-ethoxy-2-oxoethyl)thiazole-5-carboxylate |
| ethyl 2-aminothazole-4-acetic acid-5-carbethoxy ester |
| 2-Amino-4-carbethoxymethyl-5-carbethoxythiazole |
| 2-AMINO-6-QUINOLINECARBOXYLIC ACID ETHYL ESTER |
| 2-amino-5-ethoxycarbonyl-4-ethoxycarbonylmethylthiazole |