1-(Imidazolyl)-1-(2,4-dichlorophenoxy)-3,8-dimethylbutan-2-one structure
|
Common Name | 1-(Imidazolyl)-1-(2,4-dichlorophenoxy)-3,8-dimethylbutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 38083-30-6 | Molecular Weight | 327.20600 | |
| Density | 1.26g/cm3 | Boiling Point | 471.6ºC at 760mmHg | |
| Molecular Formula | C15H16Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239ºC | |
| Name | 1-(2,4-dichlorophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 471.6ºC at 760mmHg |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.20600 |
| Flash Point | 239ºC |
| Exact Mass | 326.05900 |
| PSA | 44.12000 |
| LogP | 4.38270 |
| Index of Refraction | 1.573 |
| InChIKey | DIEHOEGKOOEBCY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1Cl)n1ccnc1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2,4-dichloro-phenoxy)-1-imidazol-1-yl-3,3-dimethyl-butan-2-one |
| Bay-Ve-7294 |
| 2-Butanone,1-(2,4-dichlorophenoxy)-1-(1H-imidazol-1-yl)-3,3-dimethyl |
| 1-(Imidazolyl)-1-(2,4-dichlorophenoxy)-3,8-dimethylbutan-2-one |