5-(2-chloro-5-nitrophenyl)furan-2-carbonyl chloride
Modify Date: 2025-08-27 01:29:38
5-(2-chloro-5-nitrophenyl)furan-2-carbonyl chloride structure
|
Common Name | 5-(2-chloro-5-nitrophenyl)furan-2-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 380871-34-1 | Molecular Weight | 286.06800 | |
| Density | 1.523g/cm3 | Boiling Point | 412.9ºC at 760mmHg | |
| Molecular Formula | C11H5Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.5ºC | |
| Name | 5-(2-chloro-5-nitrophenyl)furan-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.523g/cm3 |
|---|---|
| Boiling Point | 412.9ºC at 760mmHg |
| Molecular Formula | C11H5Cl2NO4 |
| Molecular Weight | 286.06800 |
| Flash Point | 203.5ºC |
| Exact Mass | 284.96000 |
| PSA | 76.03000 |
| LogP | 4.41040 |
| Index of Refraction | 1.607 |
| InChIKey | UEBNEDSLYXBEMR-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1 |
| RIDADR | UN3261 |
|---|---|
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD02258012 |