3-[(4-methoxyphenyl)methylene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one structure
|
Common Name | 3-[(4-methoxyphenyl)methylene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one | ||
|---|---|---|---|---|
| CAS Number | 38102-63-5 | Molecular Weight | 270.36600 | |
| Density | 1.096g/cm3 | Boiling Point | 402.1ºC at 760mmHg | |
| Molecular Formula | C18H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | 2-[(4-methoxyphenyl)methylidene]-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 402.1ºC at 760mmHg |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.36600 |
| Flash Point | 170.5ºC |
| Exact Mass | 270.16200 |
| PSA | 26.30000 |
| LogP | 4.10380 |
| Index of Refraction | 1.576 |
| InChIKey | NUXVNHVEMUEEND-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=C2C(=O)C3(C)CCC2C3(C)C)cc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Anisilyden-campher |
| 3-anisal-camphor |
| 3-(4-methoxybenzylidene) camphor |
| 3-Anisal-dl-campher |
| 3-(4'-methoxy-benzylidene)-1,7,7-trimethyl-bicyclo[2.2.1]heptan-2-one |
| HMS1543F11 |
| 3-Anisal-campher |
| 3-[(4-methoxyphenyl)methylene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |