methyl 3-chloro-4-hydroxy-6-methylsalicylate structure
|
Common Name | methyl 3-chloro-4-hydroxy-6-methylsalicylate | ||
|---|---|---|---|---|
| CAS Number | 38103-07-0 | Molecular Weight | 216.61800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-chloro-2,4-dihydroxy-6-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9ClO4 |
|---|---|
| Molecular Weight | 216.61800 |
| Exact Mass | 216.01900 |
| PSA | 66.76000 |
| LogP | 1.84620 |
| InChIKey | IDVMSOLGOULRNA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C)cc(O)c(Cl)c1O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 253-782-2 |
| Methyl 3-chloro-4-hydroxy-6-methylsalicylate |
| Benzoic acid,3-chloro-2,4-dihydroxy-6-methyl-,methyl ester |