2-methyl-6-(naphthalene-1-carbonyl)benzoic acid structure
|
Common Name | 2-methyl-6-(naphthalene-1-carbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 38119-05-0 | Molecular Weight | 290.31300 | |
| Density | 1.259g/cm3 | Boiling Point | 542.4ºC at 760 mmHg | |
| Molecular Formula | C19H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.9ºC | |
| Name | 2-methyl-6-(naphthalene-1-carbonyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 542.4ºC at 760 mmHg |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.31300 |
| Flash Point | 295.9ºC |
| Exact Mass | 290.09400 |
| PSA | 54.37000 |
| LogP | 4.07740 |
| Index of Refraction | 1.665 |
| InChIKey | BXZKSJZKQCAGIB-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)c2cccc3ccccc23)c1C(=O)O |
| HS Code | 2916399090 |
|---|
|
~%
2-methyl-6-(nap... CAS#:38119-05-0 |
| Literature: Newman Journal of the American Chemical Society, 1937 , vol. 59, p. 1003,1005 |
|
~%
2-methyl-6-(nap... CAS#:38119-05-0 |
| Literature: Christiaens,L.; Renson,M. Bulletin des Societes Chimiques Belges, 1969 , vol. 78, p. 359 - 393 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 6-Methyl-2-<1>naphthoyl-benzoesaeure |